
CAS 88127-82-6
:13,13-Bis[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-3,6,9,12-tetraoxa-13-silahexadecan-16-amine
Description:
13,13-Bis[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-3,6,9,12-tetraoxa-13-silahexadecan-16-amine, with CAS number 88127-82-6, is a complex organosilicon compound characterized by its unique siloxane backbone and multiple ether functional groups. This compound features a long-chain structure that includes both silicate and ether linkages, contributing to its potential applications in various fields such as materials science and pharmaceuticals. The presence of ethoxy groups enhances its solubility in organic solvents and may improve its compatibility with other materials. Additionally, the amine functional group suggests potential reactivity, allowing for further chemical modifications. The tetraoxa structure indicates a high degree of oxygen content, which can influence the compound's properties, such as hydrophilicity and thermal stability. Overall, this compound's intricate structure and functional groups make it a subject of interest for research into novel materials and applications in drug delivery systems or surface modification technologies.
Formula:C27H59NO12Si
InChI:InChI=1S/C27H59NO12Si/c1-4-29-9-12-32-15-18-35-21-24-38-41(27-7-8-28,39-25-22-36-19-16-33-13-10-30-5-2)40-26-23-37-20-17-34-14-11-31-6-3/h4-28H2,1-3H3
InChI key:InChIKey=AYYAMGTYJZJADZ-UHFFFAOYSA-N
SMILES:[Si](OCCOCCOCCOCC)(OCCOCCOCCOCC)(OCCOCCOCCOCC)CCCN
Synonyms:- 13,13-Bis[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-3,6,9,12-tetraoxa-13-silahexadecan-16-amine
- 3,6,9,12-Tetraoxa-13-silahexadecan-16-amine, 13,13-bis[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12-Tetraoxa-13-silahexadecan-16-amine,13,13-bis[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-
CAS:Formula:C31H59NO12SiMolecular weight:665.8852
