CAS 88127-84-8
:9-[2-(2-Methoxyethoxy)ethoxy]-9-[3-(2-oxiranylmethoxy)propyl]-2,5,8,10,13,16-hexaoxa-9-silaheptadecane
Description:
The chemical substance known as 9-[2-(2-Methoxyethoxy)ethoxy]-9-[3-(2-oxiranylmethoxy)propyl]-2,5,8,10,13,16-hexaoxa-9-silaheptadecane, with the CAS number 88127-84-8, is a siloxane compound characterized by its complex structure that includes multiple ether and oxirane functional groups. This compound features a silane backbone, which contributes to its unique properties, such as flexibility and potential for forming networks or films. The presence of ether linkages enhances its solubility in organic solvents and may improve its compatibility with various materials. The oxirane group suggests potential reactivity, allowing for further functionalization or cross-linking in polymer applications. This compound is likely to exhibit low volatility and thermal stability, making it suitable for use in coatings, adhesives, or as a surfactant. Its molecular structure indicates a high degree of branching, which can influence its physical properties, such as viscosity and surface tension. Overall, this siloxane compound is of interest in materials science and polymer chemistry due to its versatile functional groups and potential applications.
Formula:C21H44O11Si
InChI:InChI=1/C21H44O11Si/c1-22-6-9-25-12-15-30-33(31-16-13-26-10-7-23-2,32-17-14-27-11-8-24-3)18-4-5-28-19-21-20-29-21/h21H,4-20H2,1-3H3
InChI key:InChIKey=BAPRPWHVXHPSHD-UHFFFAOYSA-N
SMILES:[Si](CCCOCC1CO1)(OCCOCCOC)(OCCOCCOC)OCCOCCOC
Synonyms:- 9-[2-(2-Methoxyethoxy)ethoxy]-9-[3-(oxiranylmethoxy)propyl]-2,5,8,10,13,16-hexaoxa-9-silaheptadecane
- 9-[2-(2-Methoxyethoxy)ethoxy]-9-[3-(2-oxiranylmethoxy)propyl]-2,5,8,10,13,16-hexaoxa-9-silaheptadecane
- 9-(2-(2-Methoxyethoxy)ethoxy)-9-(3-(oxiranylmethoxy)propyl)-2,5,8,10,13,16-hexaoxa-9-silaheptadecane
- 2,5,8,10,13,16-Hexaoxa-9-silaheptadecane, 9-[2-(2-methoxyethoxy)ethoxy]-9-[3-(oxiranylmethoxy)propyl]-
- tris[2-(2-methoxyethoxy)ethoxy]-[3-(oxiran-2-ylmethoxy)propyl]silane
- RAM 1087
- 2,5,8,10,13,16-Hexaoxa-9-silaheptadecane, 9-[2-(2-methoxyethoxy)ethoxy]-9-[3-(2-oxiranylmethoxy)propyl]-
- Einecs 289-390-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5,8,10,13,16-Hexaoxa-9-silaheptadecane,9-[2-(2-methoxyethoxy)ethoxy]-9-[3-(2-oxiranylmethoxy)propyl]-
CAS:Formula:C21H44O11SiMolecular weight:500.653
