CymitQuimica logo

CAS 88129-41-3

:

2,9-Dihydro-9-methyl-3-(trimethoxymethyl)-1H-pyrido[3,4-b]indol-1-one

Description:
2,9-Dihydro-9-methyl-3-(trimethoxymethyl)-1H-pyrido[3,4-b]indol-1-one, with the CAS number 88129-41-3, is a complex organic compound belonging to the class of pyridoindoles. This substance features a fused bicyclic structure that incorporates both pyridine and indole moieties, contributing to its potential biological activity. The presence of the trimethoxymethyl group enhances its solubility and reactivity, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit various pharmacological properties, including anti-cancer, anti-inflammatory, or neuroprotective effects, although specific biological activities would depend on further empirical studies. The compound's molecular structure suggests it may engage in hydrogen bonding and π-π interactions, which could influence its behavior in biological systems. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H18N2O4
InChI:InChI=1S/C16H18N2O4/c1-18-12-8-6-5-7-10(12)11-9-13(17-15(19)14(11)18)16(20-2,21-3)22-4/h5-9H,1-4H3,(H,17,19)
InChI key:InChIKey=VHLAMPVEYRVYLX-UHFFFAOYSA-N
SMILES:CN1C2=C(C=3C1=CC=CC3)C=C(C(OC)(OC)OC)NC2=O
Synonyms:
  • 1H-Pyrido[3,4-b]indol-1-one, 2,9-dihydro-9-methyl-3-(trimethoxymethyl)-
  • 2,9-Dihydro-9-methyl-3-(trimethoxymethyl)-1H-pyrido[3,4-b]indol-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.