CymitQuimica logo

CAS 881310-87-8

:

Quinazoline,2-(4-bromophenyl)-4-chloro-6-fluoro-

Description:
Quinazoline, 2-(4-bromophenyl)-4-chloro-6-fluoro- is a heterocyclic compound that belongs to the quinazoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyrimidine ring. This specific compound features a bromine atom at the para position of the phenyl group, a chlorine atom at the 4-position, and a fluorine atom at the 6-position of the quinazoline ring. These halogen substituents can significantly influence the compound's chemical reactivity, solubility, and biological activity. Quinazolines are known for their diverse pharmacological properties, including potential applications in medicinal chemistry as anti-cancer, anti-inflammatory, and anti-microbial agents. The presence of multiple halogens can enhance lipophilicity and alter the compound's interaction with biological targets. Additionally, the compound's molecular structure contributes to its stability and potential for forming various derivatives through further chemical modifications. Overall, this compound exemplifies the complexity and utility of halogenated heterocycles in drug discovery and development.
Formula:C14H7BrClFN2
InChI:InChI=1S/C14H7BrClFN2/c15-9-3-1-8(2-4-9)14-18-12-6-5-10(17)7-11(12)13(16)19-14/h1-7H
SMILES:c1cc(ccc1c1nc2ccc(cc2c(Cl)n1)F)Br
Synonyms:
  • 2-(4-Bromo-Phenyl)-4-Chloro-6-Fluoro-Quinazoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.