CymitQuimica logo

CAS 881313-89-9

:

2,4-Dichloro-6-fluoro-3-quinolinecarbonitrile

Description:
2,4-Dichloro-6-fluoro-3-quinolinecarbonitrile is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features two chlorine atoms and one fluorine atom, contributing to its unique reactivity and potential biological activity. The presence of the cyano group (–C≡N) enhances its chemical properties, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. Additionally, the halogen substituents can influence the compound's lipophilicity and bioavailability, which are critical factors in drug design. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichloro-6-fluoro-3-quinolinecarbonitrile represents a significant compound in the field of organic synthesis and medicinal chemistry.
Formula:C10H3Cl2FN2
InChI:InChI=1S/C10H3Cl2FN2/c11-9-6-3-5(13)1-2-8(6)15-10(12)7(9)4-14/h1-3H
InChI key:GNNKGLQCSCJBCA-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)c(c(C#N)c(Cl)n2)Cl
Synonyms:
  • 3-Quinolinecarbonitrile, 2,4-dichloro-6-fluoro-
Found 5 products.