CymitQuimica logo

CAS 88133-88-4

:

(4E)-2-[3-(dimethylamino)propyl]-5,9-dimethyldeca-4,8-dienoic acid

Description:
The chemical substance known as (4E)-2-[3-(dimethylamino)propyl]-5,9-dimethyldeca-4,8-dienoic acid, with the CAS number 88133-88-4, is a complex organic compound characterized by its unique structure, which includes a long carbon chain with multiple double bonds (conjugated system) and a dimethylamino group. This compound is likely to exhibit properties typical of unsaturated fatty acids, such as being a liquid at room temperature and having a relatively low melting point. The presence of the dimethylamino group suggests potential basicity and the ability to form salts or complexes with acids. Additionally, the conjugated double bonds may contribute to its reactivity, making it a candidate for various chemical reactions, including polymerization or addition reactions. The compound's specific applications may vary, but it could be relevant in fields such as pharmaceuticals, agrochemicals, or materials science, where its unique structural features can be exploited for specific functionalities. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C17H31NO2
InChI:InChI=1/C17H31NO2/c1-14(2)8-6-9-15(3)11-12-16(17(19)20)10-7-13-18(4)5/h8,11,16H,6-7,9-10,12-13H2,1-5H3,(H,19,20)/b15-11+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.