CAS 88137-93-3

Acetamide, N-[4-[[10-(1H-imidazol-1-yl)decyl]oxy]phenyl]-

Description:

Acetamide, N-[4-[[10-(1H-imidazol-1-yl)decyl]oxy]phenyl]- is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a long aliphatic chain, specifically a decyl group, linked to an aromatic ring that is substituted with an imidazole moiety, contributing to its potential biological activity. The presence of the imidazole ring suggests possible interactions with biological systems, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic decyl chain, while the polar amide and imidazole groups may enhance its solubility in polar solvents. Its structure indicates potential applications in pharmaceuticals, particularly in drug design, where the balance between hydrophilicity and lipophilicity is crucial for bioavailability. Additionally, the compound's unique features may allow it to engage in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability in various environments.

Formula: C₂₁H₃₁N₃O₂

InChI: InChI=1S/C21H31N3O2/c1-19(25)23-20-10-12-21(13-11-20)26-17-9-7-5-3-2-4-6-8-15-24-16-14-22-18-24/h10-14,16,18H,2-9,15,17H2,1H3,(H,23,25)

InChI key: MSXVGBIMJQBWRI-UHFFFAOYSA-N

SMILES: CC(=O)NC1=CC=C(C=C1)OCCCCCCCCCCN2C=CN=C2