CAS 88137-95-5

Acetamide, N-[2-[[5-(1H-imidazol-1-yl)pentyl]oxy]phenyl]-

Description:

Acetamide, N-[2-[[5-(1H-imidazol-1-yl)pentyl]oxy]phenyl]- is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a phenyl ring substituted with a pentyl chain that is further connected to an imidazole moiety, contributing to its potential biological activity. The presence of the imidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The ether linkage (–O–) between the pentyl chain and the phenyl group enhances its solubility and may influence its pharmacokinetic properties. Acetamides generally exhibit moderate polarity, which can affect their interaction with biological membranes. The specific structure of this compound may confer unique properties, such as selective binding to certain receptors or enzymes. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or as a biochemical probe, although further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₆H₂₁N₃O₂

InChI: InChI=1S/C16H21N3O2/c1-14(20)18-15-7-3-4-8-16(15)21-12-6-2-5-10-19-11-9-17-13-19/h3-4,7-9,11,13H,2,5-6,10,12H2,1H3,(H,18,20)

InChI key: JQPBECKVWRPAGJ-UHFFFAOYSA-N

SMILES: CC(=O)NC1=CC=CC=C1OCCCCCN2C=CN=C2