CAS 88138-25-4

Benzamide, N-[4-[[5-(4-methyl-1H-imidazol-1-yl)pentyl]oxy]phenyl]-

Description:

Benzamide, N-[4-[[5-(4-methyl-1H-imidazol-1-yl)pentyl]oxy]phenyl]- (CAS 88138-25-4) is a chemical compound characterized by its complex structure, which includes a benzamide moiety linked to a phenyl group that is further substituted with a pentyl chain containing an imidazole ring. This compound typically exhibits properties associated with both amides and aromatic compounds, such as moderate solubility in organic solvents and potential bioactivity due to the presence of the imidazole group, which is known for its role in biological systems. The presence of the alkyl chain may influence its lipophilicity, affecting its interaction with biological membranes. Additionally, the compound may exhibit various chemical reactivities typical of amides, including hydrolysis under certain conditions. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₂₂H₂₅N₃O₂

InChI: InChI=1S/C22H25N3O2/c1-18-16-25(17-23-18)14-6-3-7-15-27-21-12-10-20(11-13-21)24-22(26)19-8-4-2-5-9-19/h2,4-5,8-13,16-17H,3,6-7,14-15H2,1H3,(H,24,26)

InChI key: YJVJZRAFUVSKDX-UHFFFAOYSA-N

SMILES: CC1=CN(C=N1)CCCCCOC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3