CAS 88138-34-5

Acetamide, N-[2-[4-[[5-(1H-imidazol-1-yl)pentyl]oxy]phenyl]ethyl]-

Description:

Acetamide, N-[2-[4-[[5-(1H-imidazol-1-yl)pentyl]oxy]phenyl]ethyl]- is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a complex structure that includes an imidazole ring, a pentyl chain, and a phenyl group, indicating potential biological activity and interactions. The presence of the imidazole moiety suggests that it may exhibit properties relevant to pharmacology, as imidazole derivatives are often found in various bioactive compounds. The ether linkage (–O–) in the structure may enhance solubility and influence the compound's overall stability and reactivity. Additionally, the compound's molecular architecture implies potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its CAS number, 88138-34-5, allows for easy identification and reference in chemical databases. Overall, this compound's unique structural features may contribute to its functional properties, making it of interest in both research and industrial applications.

Formula: C₁₈H₂₅N₃O₂

InChI: InChI=1S/C18H25N3O2/c1-16(22)20-10-9-17-5-7-18(8-6-17)23-14-4-2-3-12-21-13-11-19-15-21/h5-8,11,13,15H,2-4,9-10,12,14H2,1H3,(H,20,22)

InChI key: DERQKBBFBCJDEW-UHFFFAOYSA-N

SMILES: CC(=O)NCCC1=CC=C(C=C1)OCCCCCN2C=CN=C2