CAS 88138-56-1
:1-[(6-Bromohexyl)oxy]-4-methyl-2-nitrobenzene
Description:
1-[(6-Bromohexyl)oxy]-4-methyl-2-nitrobenzene, with the CAS number 88138-56-1, is an organic compound characterized by its complex structure, which includes a nitro group, a brominated alkyl chain, and a methyl-substituted aromatic ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group, which can participate in electrophilic substitution reactions. The bromine atom in the hexyl chain may also impart unique reactivity, making it a candidate for further chemical transformations. Additionally, the presence of the nitro group suggests that the compound may have applications in materials science or as an intermediate in organic synthesis. Safety considerations should be taken into account due to the potential toxicity of nitro compounds and halogenated substances. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.
Formula:C13H18BrNO3
InChI:InChI=1S/C13H18BrNO3/c1-11-6-7-13(12(10-11)15(16)17)18-9-5-3-2-4-8-14/h6-7,10H,2-5,8-9H2,1H3
InChI key:InChIKey=MYGQGNRSAXLONW-UHFFFAOYSA-N
SMILES:O(CCCCCCBr)C1=C(N(=O)=O)C=C(C)C=C1
Synonyms:- 1-[(6-Bromohexyl)oxy]-4-methyl-2-nitrobenzene
- Benzene, 1-[(6-bromohexyl)oxy]-4-methyl-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
