CAS 88138-63-0

1H-Imidazole, 1-[5-(3-nitrophenoxy)pentyl]-

Description:

1H-Imidazole, 1-[5-(3-nitrophenoxy)pentyl]- is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a pentyl chain substituted with a 3-nitrophenoxy group, contributing to its unique properties. The presence of the nitro group indicates potential for reactivity and influence on the compound's electronic properties, while the imidazole moiety is known for its role in biological systems, particularly in enzyme catalysis and as a building block in pharmaceuticals. The compound's structure suggests it may exhibit polar characteristics due to the nitrophenoxy group, which could affect its solubility and interaction with biological targets. Additionally, the imidazole ring can participate in hydrogen bonding, making it relevant in various chemical and biological applications. Overall, this compound's unique structural features may lend it potential utility in medicinal chemistry and material science.

Formula: C₁₄H₁₇N₃O₃

InChI: InChI=1S/C14H17N3O3/c18-17(19)13-5-4-6-14(11-13)20-10-3-1-2-8-16-9-7-15-12-16/h4-7,9,11-12H,1-3,8,10H2

InChI key: NMEHAUNGLVJLMO-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)OCCCCCN2C=CN=C2)[N+](=O)[O-]