CAS 88138-72-1

Benzenamine, 4-[3-(1H-imidazol-1-yl)propoxy]-

Description:

Benzenamine, 4-[3-(1H-imidazol-1-yl)propoxy]- is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with an amine group and a propoxy chain that includes an imidazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine and imidazole functional groups. The imidazole ring contributes to its biological activity, often enhancing its interaction with biological targets, making it of interest in medicinal chemistry. The presence of the propoxy group may influence its lipophilicity and overall pharmacokinetic properties. Additionally, compounds like this can be involved in various applications, including pharmaceuticals, agrochemicals, and materials science, due to their diverse functional characteristics. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1S/C12H15N3O/c13-11-2-4-12(5-3-11)16-9-1-7-15-8-6-14-10-15/h2-6,8,10H,1,7,9,13H2

InChI key: FUFQPMKTPZSCFI-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1N)OCCCN2C=CN=C2