CAS 88138-82-3

Benzenamine, 4-[[6-(1H-benzimidazol-1-yl)hexyl]oxy]-

Description:

Benzenamine, 4-[[6-(1H-benzimidazol-1-yl)hexyl]oxy]- is an organic compound characterized by its amine functional group and a benzimidazole moiety, which contributes to its biological activity and potential applications in pharmaceuticals. The structure features a hexyl chain that connects the benzimidazole to a phenyl ring, enhancing its lipophilicity and possibly influencing its solubility and permeability in biological systems. This compound may exhibit properties such as antimicrobial or anticancer activity, typical of benzimidazole derivatives, due to the presence of the aromatic and heterocyclic structures. Its molecular interactions can be influenced by the amine group, which can participate in hydrogen bonding, making it a candidate for various chemical reactions and applications in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, benzenamine derivatives like this one are of interest in research for their diverse chemical properties and potential therapeutic benefits.

Formula: C₁₉H₂₃N₃O

InChI: InChI=1S/C19H23N3O/c20-16-9-11-17(12-10-16)23-14-6-2-1-5-13-22-15-21-18-7-3-4-8-19(18)22/h3-4,7-12,15H,1-2,5-6,13-14,20H2

InChI key: HWVVUEUDLLPJDH-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)N=CN2CCCCCCOC3=CC=C(C=C3)N