CAS 881388-88-1

(6aS,8S,10S,11R,12aR,12bS,12cS)-1,2,5,6,6a,7,9,10,11,12,12a,12b-Dodecahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-4H-11,12c-methanoazuleno[4,5-a]indolizine-4,13-dione

Description:

The chemical substance with the name "(6aS,8S,10S,11R,12aR,12bS,12cS)-1,2,5,6,6a,7,9,10,11,12,12a,12b-Dodecahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-4H-11,12c-methanoazuleno[4,5-a]indolizine-4,13-dione" and CAS number "881388-88-1" is a complex organic compound characterized by its intricate polycyclic structure. It features multiple stereocenters, indicating that it exists in specific three-dimensional configurations that can significantly influence its chemical behavior and biological activity. The presence of functional groups, such as the hydroxyethyl group and the dione moiety, suggests potential reactivity and interactions with biological systems. This compound may exhibit properties typical of indolizine derivatives, which are known for their diverse applications in medicinal chemistry, including potential antitumor and antimicrobial activities. Its structural complexity and stereochemistry may also contribute to unique pharmacokinetic and pharmacodynamic profiles, making it a subject of interest in drug development and research. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₂₁H₂₉NO₃

InChI: InChI=1S/C21H29NO3/c1-12-10-22-11-14-3-4-16(24)18-13(6-8-23)5-7-21(18)19(25)15(12)9-17(22)20(14,21)2/h12,14-15,17,23H,3-11H2,1-2H3/t12-,14-,15-,17-,20-,21+/m1/s1

InChI key: InChIKey=XALHQXXUICHGPI-YSQOEHLKSA-N

SMILES: C[C@@]12[C@]34C(=C(CCO)CC3)C(=O)CC[C@@]1(C[N@]5[C@@]2(C[C@@](C4=O)([C@H](C)C5)[H])[H])[H]

Synonyms:

• 1H-11,12c-Methanoazuleno[4,5-a]indolizine-4,13(2H)-dione, 5,6,6a,7,9,10,11,12,12a,12b-decahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-, (6aS,8S,10S,11R,12aR,12bS,12cS)-
• 4H-11,12c-Methanoazuleno[4,5-a]indolizine-4,13-dione, 1,2,5,6,6a,7,9,10,11,12,12a,12b-dodecahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-, (6aS,8S,10S,11R,12aR,12bS,12cS)-
• Daphniyunnine B
• (6aS,8S,10S,11R,12aR,12bS,12cS)-1,2,5,6,6a,7,9,10,11,12,12a,12b-Dodecahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-4H-11,12c-methanoazuleno[4,5-a]indolizine-4,13-dione
• Longeracinphyllin B

Daphniyunnine B

CAS: 881388-88-1

Daphniyunnine B is a natural product from Daphniphyllum macropodum Miq.

Formula: C₂₁H₂₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 343.46

Ref: TM-TN3770

Daphniyunnine B

CAS: 881388-88-1

Daphniyunnine B is a naturally occurring alkaloid, which is derived from the plant genus Daphniphyllum. This compound is isolated from these plants, known for their diverse range of bioactive compounds. Daphniyunnine B displays a complex molecular structure characteristic of alkaloids found in these species.

Formula: C₂₁H₂₉NO₃

Purity: Min. 95%

Molecular weight: 343.5 g/mol

Ref: 3D-GKB38888