CAS 88139-85-9

2-Azetidinone, 4-[2-(2-furanyl)-2,2-bis(methylthio)ethyl]-, (S)-

Description:

2-Azetidinone, 4-[2-(2-furanyl)-2,2-bis(methylthio)ethyl]-, (S)-, with CAS number 88139-85-9, is a chemical compound characterized by its azetidinone ring structure, which is a four-membered lactam. This compound features a furan moiety, contributing to its aromatic properties, and two methylthio groups that enhance its reactivity and solubility. The (S)- designation indicates that it possesses a specific stereochemistry, which can influence its biological activity and interactions. The presence of the furan ring suggests potential applications in organic synthesis and medicinal chemistry, as furan derivatives are often explored for their pharmacological properties. Additionally, the compound's unique structure may confer specific characteristics such as stability, solubility in organic solvents, and potential for forming hydrogen bonds. Overall, 2-Azetidinone, 4-[2-(2-furanyl)-2,2-bis(methylthio)ethyl]-, (S)- is of interest in various fields, including drug development and materials science, due to its distinctive chemical features.

Formula: C₁₁H₁₅NO₂S₂

InChI: InChI=1S/C11H15NO2S2/c1-15-11(16-2,9-4-3-5-14-9)7-8-6-10(13)12-8/h3-5,8H,6-7H2,1-2H3,(H,12,13)/t8-/m0/s1

InChI key: NUFZLKSLIMDTFD-QMMMGPOBSA-N

SMILES: CSC(C[C@@H]1CC(=O)N1)(C2=CC=CO2)SC