CymitQuimica logo

CAS 88139-92-8

:

5-Bromo-2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine

Description:
5-Bromo-2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine, with the CAS number 88139-92-8, is a chemical compound characterized by its unique structure that includes a bromine atom, a pyridine ring, and a silyl ether functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, making it a valuable intermediate in synthetic chemistry. Additionally, the bromine substituent can serve as a versatile leaving group in further transformations. Safety data should be consulted, as it may pose health risks if not handled properly, including potential irritant effects. Overall, this compound exemplifies the complexity and utility of organosilicon chemistry in modern applications.
Formula:C12H20BrNOSi
InChI:InChI=1S/C12H20BrNOSi/c1-12(2,3)16(4,5)15-9-11-7-6-10(13)8-14-11/h6-8H,9H2,1-5H3
InChI key:InChIKey=RQWUXKJRTKREAL-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1=CC=C(Br)C=N1
Synonyms:
  • 5-Bromo-2-[[(tert-butyldimethylsilyl)oxy]methyl]pyridine
  • 5-Bromo-2-[[(tert-butyldimethylsilanyl)oxy]methyl]pyridine
  • Pyridine, 5-bromo-2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-
  • [(5-Bromo-2-pyridyl)methoxy](tert-butyl)dimethylsilane
  • 5-Bromo-2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.