CAS 881402-43-3
:4-(4-Methylphenoxy)benzenepropanoic acid
Description:
4-(4-Methylphenoxy)benzenepropanoic acid, identified by its CAS number 881402-43-3, is an organic compound characterized by its aromatic structure and functional groups. It features a propanoic acid moiety attached to a benzene ring that is further substituted with a 4-methylphenoxy group. This compound exhibits properties typical of aromatic acids, including potential solubility in organic solvents and moderate solubility in water, depending on the pH. Its molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, influencing its reactivity and interactions with other molecules. The presence of the methyl and phenoxy substituents can affect its physical properties, such as melting point and boiling point, as well as its biological activity. Compounds of this nature may be of interest in pharmaceutical applications or as intermediates in organic synthesis, given their potential to interact with biological systems or serve as building blocks for more complex molecules. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C16H16O3
InChI:InChI=1S/C16H16O3/c1-12-2-7-14(8-3-12)19-15-9-4-13(5-10-15)6-11-16(17)18/h2-5,7-10H,6,11H2,1H3,(H,17,18)
InChI key:InChIKey=MPQSXWBRYQHUQC-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CCC(O)=O)C=C1)C2=CC=C(C)C=C2
Synonyms:- 4-(4-Methylphenoxy)benzenepropanoic acid
- Benzenepropanoic acid, 4-(4-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
