CymitQuimica logo

CAS 881406-26-4

:

1-(benzenesulfonyl)pyrrole-3-sulfonyl chloride

Description:
1-(Benzenesulfonyl)pyrrole-3-sulfonyl chloride is a sulfonamide compound characterized by the presence of both pyrrole and sulfonyl functional groups. This compound typically appears as a solid or crystalline substance, exhibiting high reactivity due to the presence of the sulfonyl chloride functional group, which can readily participate in nucleophilic substitution reactions. It is soluble in polar organic solvents, making it useful in various synthetic applications. The compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. Additionally, it may exhibit biological activity, although specific biological properties would depend on the context of its use and the presence of other functional groups in a larger molecular framework. As with many sulfonyl chlorides, it should be handled with care due to its potential to release hydrochloric acid upon reaction with water or alcohols, which can lead to corrosive effects. Proper safety measures should be observed when working with this compound.
Formula:C10H8ClNO4S2
InChI:InChI=1/C10H8ClNO4S2/c11-17(13,14)10-6-7-12(8-10)18(15,16)9-4-2-1-3-5-9/h1-8H
SMILES:c1ccc(cc1)S(=O)(=O)n1ccc(c1)S(=O)(=O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.