CAS 881406-31-1

6-Bromo-1-(phenylsulfonyl)-1H-indole-3-sulfonyl chloride

Description:

6-Bromo-1-(phenylsulfonyl)-1H-indole-3-sulfonyl chloride is a synthetic organic compound characterized by its complex structure, which includes an indole core substituted with both bromine and sulfonyl groups. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. The bromine atom introduces additional electrophilic character, making it useful in various chemical transformations. It is often employed in medicinal chemistry and research applications, particularly in the development of pharmaceuticals, due to its potential biological activity. The presence of the phenylsulfonyl group enhances its solubility and stability in organic solvents. As with many sulfonyl chlorides, it is important to handle this compound with care, as it can be reactive and may release toxic gases upon hydrolysis. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₄H₉BrClNO₄S₂

InChI: InChI=1S/C14H9BrClNO4S2/c15-10-6-7-12-13(8-10)17(9-14(12)22(16,18)19)23(20,21)11-4-2-1-3-5-11/h1-9H

InChI key: InChIKey=AWFUOHRETTWMOA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C(S(Cl)(=O)=O)=C1)=CC=C(Br)C2)C3=CC=CC=C3

Synonyms:

• 1H-Indole-3-sulfonyl chloride, 6-bromo-1-(phenylsulfonyl)-
• 6-Bromo-1-(phenylsulfonyl)-1H-indole-3-sulfonyl chloride

6-Bromo-1-(phenylsulfonyl)-1H-indole-3-sulfonyl chloride

CAS: 881406-31-1

Formula: C₁₄H₉BrClNO₄S₂

Molecular weight: 434.7126

Ref: IN-DA004F28