CAS 88141-36-0

Benzene, 1,3,5-tris(1-methylethyl)-2-(methylseleno)-

Description:

Benzene, 1,3,5-tris(1-methylethyl)-2-(methylseleno)-, also known by its CAS number 88141-36-0, is an organic compound characterized by a benzene ring substituted with three isopropyl groups and one methylselenyl group. The presence of the methylselenyl group introduces selenium into the molecular structure, which can impart unique chemical properties and biological activities. This compound is typically non-polar due to the hydrophobic nature of the benzene ring and the isopropyl substituents, making it soluble in organic solvents but not in water. The isopropyl groups contribute to steric hindrance, potentially affecting the compound's reactivity and interactions with other molecules. Additionally, the selenium atom can participate in redox reactions, which may influence the compound's behavior in biological systems. Overall, this compound's structure suggests potential applications in organic synthesis, medicinal chemistry, or as a precursor for further chemical modifications, although specific applications would depend on ongoing research and development.

Formula: C₁₆H₂₆Se

InChI: InChI=1S/C16H26Se/c1-10(2)13-8-14(11(3)4)16(17-7)15(9-13)12(5)6/h8-12H,1-7H3

InChI key: RZGZZQBLEBKXKX-UHFFFAOYSA-N

SMILES: CC(C)C1=CC(=C(C(=C1)C(C)C)[Se]C)C(C)C