CAS 88141-39-3

2-Cyclohexen-1-one, 3-(2-naphthalenyl)-, oxime

Description:

2-Cyclohexen-1-one, 3-(2-naphthalenyl)-, oxime, with the CAS number 88141-39-3, is an organic compound characterized by its oxime functional group, which is derived from the reaction of a ketone with hydroxylamine. This compound features a cyclohexene ring, contributing to its cyclic structure and potential reactivity. The presence of the naphthalene moiety indicates that it has aromatic characteristics, which can influence its stability and reactivity. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential applications in organic synthesis or as intermediates in chemical reactions. The oxime functional group can participate in various chemical transformations, including rearrangements and condensation reactions. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Overall, the unique combination of cyclic and aromatic structures in 2-Cyclohexen-1-one, 3-(2-naphthalenyl)-, oxime suggests a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₆H₁₅NO

InChI: InChI=1S/C16H15NO/c18-17-16-7-3-6-14(11-16)15-9-8-12-4-1-2-5-13(12)10-15/h1-2,4-5,8-11,18H,3,6-7H2

InChI key: YNJFFZZLDNIZTP-UHFFFAOYSA-N

SMILES: C1CC(=CC(=NO)C1)C2=CC3=CC=CC=C3C=C2