CAS 88141-79-1

1-Piperidinepropanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-

Description:

1-Piperidinepropanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]- is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. The presence of the propanamide functional group indicates that it has amide characteristics, which can influence its solubility and reactivity. The compound features a substituted phenyl group, specifically a 4-hydroxy-3-methoxyphenyl moiety, which may enhance its interaction with biological targets due to the presence of hydroxyl and methoxy groups that can participate in hydrogen bonding and hydrophobic interactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neurochemistry or as a therapeutic agent. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile. As with many chemical substances, proper handling and safety protocols should be observed due to the unknowns associated with its biological effects.

Formula: C₁₆H₂₄N₂O₃

InChI: InChI=1S/C16H24N2O3/c1-21-15-11-13(5-6-14(15)19)12-17-16(20)7-10-18-8-3-2-4-9-18/h5-6,11,19H,2-4,7-10,12H2,1H3,(H,17,20)

InChI key: RJWRVHPGPKDPSM-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)CNC(=O)CCN2CCCCC2)O