CAS 88142-07-8

1,3-Dithiolane, 2-(1-methylethyl)-2-phenyl-

Description:

1,3-Dithiolane, 2-(1-methylethyl)-2-phenyl-, with the CAS number 88142-07-8, is a heterocyclic organic compound characterized by a five-membered ring containing two sulfur atoms and three carbon atoms. The structure features a phenyl group and an isopropyl group attached to the dithiolane ring, contributing to its unique chemical properties. This compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of sulfur atoms in the ring can impart specific reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitution. Additionally, compounds like this may have applications in organic synthesis, materials science, and potentially in pharmaceuticals, although specific applications can vary based on further research and development. Safety data should be consulted for handling and storage, as compounds containing sulfur can sometimes pose risks related to toxicity or reactivity.

Formula: C₁₂H₁₆S₂

InChI: InChI=1S/C12H16S2/c1-10(2)12(13-8-9-14-12)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3

InChI key: OOOLVHFGOIPRDU-UHFFFAOYSA-N

SMILES: CC(C)C1(SCCS1)C2=CC=CC=C2