CAS 88142-48-7

2-Propenoic acid, 3-[3-(4-chlorobenzoyl)phenyl]-, ethyl ester, (E)-

Description:

2-Propenoic acid, 3-[3-(4-chlorobenzoyl)phenyl]-, ethyl ester, commonly known by its CAS number 88142-48-7, is an organic compound characterized by its structure, which includes an acrylic acid moiety and an ethyl ester functional group. This compound features a phenyl ring substituted with a 4-chlorobenzoyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of the chlorobenzoyl group may impart specific reactivity, making it useful in various chemical syntheses and applications, particularly in the fields of polymer chemistry and materials science. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling, as it may pose health risks if not managed properly. Overall, this compound represents a versatile building block in organic synthesis and materials development.

Formula: C₁₈H₁₅ClO₃

InChI: InChI=1S/C18H15ClO3/c1-2-22-17(20)11-6-13-4-3-5-15(12-13)18(21)14-7-9-16(19)10-8-14/h3-12H,2H2,1H3/b11-6+

InChI key: CLVSRVCLSYKQSU-IZZDOVSWSA-N

SMILES: CCOC(=O)/C=C/C1=CC(=CC=C1)C(=O)C2=CC=C(C=C2)Cl