CAS 88142-50-1

S-benzyl 4-[(diaminomethylidene)amino]benzenecarbothioate hydrochloride (1:1)

Description:

S-benzyl 4-[(diaminomethylidene)amino]benzenecarbothioate hydrochloride (1:1) is a chemical compound characterized by its unique structural features, which include a benzyl group and a carbothioate moiety. This compound typically exhibits properties associated with both thiol and amine functionalities, making it potentially reactive in various chemical environments. The presence of the diaminomethylidene group suggests that it may participate in nucleophilic reactions, while the carbothioate component can engage in thiol-related chemistry. As a hydrochloride salt, it is likely to be soluble in water, which is a common characteristic of many hydrochloride salts, enhancing its utility in biological and chemical applications. The compound may also display biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. However, specific applications and biological effects would require further investigation through empirical studies. Overall, this compound represents a complex structure with diverse potential applications in medicinal chemistry and related fields.

Formula: C₁₅H₁₆ClN₃OS

InChI: InChI=1/C15H15N3OS.ClH/c16-15(17)18-13-8-6-12(7-9-13)14(19)20-10-11-4-2-1-3-5-11;/h1-9H,10H2,(H4,16,17,18);1H

Benzenecarbothioicacid, 4-[(aminoiminomethyl)amino]-, S-(phenylmethyl) ester, hydrochloride (1:1)

CAS: 88142-50-1

Formula: C₁₅H₁₅N₃OS

Molecular weight: 285.3641

Ref: IN-DA004EET