CAS 881423-32-1

4-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]-2-methyl-3-pyridinecarbonitrile

Description:

4-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]-2-methyl-3-pyridinecarbonitrile, with the CAS number 881423-32-1, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring, a phenyl group, and a cyano functional group. The presence of a dimethylsilyl ether moiety contributes to its unique chemical properties, enhancing its stability and solubility in organic solvents. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic and polar functional groups. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in areas requiring specific interactions with biological targets. The presence of the cyano group may also impart certain reactivity, making it a candidate for further chemical modifications. Overall, this compound's characteristics, including its molecular weight, solubility, and reactivity, would be essential for understanding its behavior in various chemical environments and potential applications in research and industry.

Formula: C₁₉H₂₄N₂OSi

InChI: InChI=1S/C19H24N2OSi/c1-14-18(13-20)17(11-12-21-14)15-7-9-16(10-8-15)22-23(5,6)19(2,3)4/h7-12H,1-6H3

InChI key: InChIKey=QFNWSLHZBYELDL-UHFFFAOYSA-N

SMILES: C(#N)C=1C(=CC=NC1C)C2=CC=C(O[Si](C(C)(C)C)(C)C)C=C2

Synonyms:

• 3-Pyridinecarbonitrile, 4-[4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]phenyl]-2-methyl-
• 4-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]phenyl]-2-methyl-3-pyridinecarbonitrile

4-(4-{[tert-butyl(dimethyl)silyl]oxy}phenyl)-2-methylnicotinonitrile

CAS: 881423-32-1

Formula: C₁₉H₂₄N₂OSi

Purity: 95.0%

Molecular weight: 324.499

Ref: 10-F312341