CymitQuimica logo

CAS 88144-74-5

:

2-{[(2-ethyl-4-oxohexyl)oxy]carbonyl}benzoic acid

Description:
2-{[(2-ethyl-4-oxohexyl)oxy]carbonyl}benzoic acid, with the CAS number 88144-74-5, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety and an ester functional group. This compound features a carbonyl group adjacent to a long alkyl chain, contributing to its hydrophobic properties. The presence of the ethyl and hexyl groups enhances its lipophilicity, making it potentially useful in various applications, including pharmaceuticals and materials science. The carboxylic acid functional group imparts acidic characteristics, allowing for potential interactions in biological systems or chemical reactions. Additionally, the compound may exhibit specific solubility properties depending on the solvent used, influenced by its hydrophobic and hydrophilic regions. Its unique structure may also lead to interesting thermal and photophysical properties, which could be explored in research and industrial applications. Overall, this compound's characteristics make it a subject of interest in the fields of organic chemistry and material science.
Formula:C16H20O5
InChI:InChI=1/C16H20O5/c1-3-11(9-12(17)4-2)10-21-16(20)14-8-6-5-7-13(14)15(18)19/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,19)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.