CymitQuimica logo

CAS 88144-75-6

:

2-{[(5-carboxy-2-ethyl-4-oxopentyl)oxy]carbonyl}benzoic acid

Description:
2-{[(5-carboxy-2-ethyl-4-oxopentyl)oxy]carbonyl}benzoic acid, with the CAS number 88144-75-6, is a complex organic compound characterized by its multi-functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of a carboxylic acid group indicates that it can participate in acid-base reactions, while the ester functionality suggests it may engage in nucleophilic substitution reactions. The compound's structure includes a long aliphatic chain, which can influence its solubility and hydrophobicity, making it potentially useful in various applications, including pharmaceuticals and materials science. Its unique combination of functional groups may also impart specific biological activities or reactivity patterns, making it of interest for further research in medicinal chemistry or polymer development. Overall, the compound's characteristics are defined by its structural complexity, functional diversity, and potential reactivity, which can be explored in various chemical contexts.
Formula:C16H18O7
InChI:InChI=1/C16H18O7/c1-2-10(7-11(17)8-14(18)19)9-23-16(22)13-6-4-3-5-12(13)15(20)21/h3-6,10H,2,7-9H2,1H3,(H,18,19)(H,20,21)
SMILES:CCC(CC(=O)CC(=O)O)COC(=O)c1ccccc1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.