CymitQuimica logo

CAS 88144-77-8

:

2-({[2-(carboxymethyl)-4-hydroxyhexyl]oxy}carbonyl)benzoic acid

Description:
2-({[2-(carboxymethyl)-4-hydroxyhexyl]oxy}carbonyl)benzoic acid, with the CAS number 88144-77-8, is a complex organic compound characterized by its carboxylic acid functional group and a hydroxyalkyl chain. This substance features a benzoic acid core, which is substituted with a carboxymethyl group and a hydroxyhexyl moiety, contributing to its hydrophilicity and potential biological activity. The presence of multiple functional groups suggests that it may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding, and reactivity in various chemical reactions. Its structural complexity may also indicate potential applications in pharmaceuticals, biochemistry, or materials science, particularly in the development of drug delivery systems or as a biochemical probe. The compound's stability, reactivity, and interactions with biological systems would depend on its specific molecular structure and the environment in which it is used. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C16H20O7
InChI:InChI=1/C16H20O7/c1-2-11(17)7-10(8-14(18)19)9-23-16(22)13-6-4-3-5-12(13)15(20)21/h3-6,10-11,17H,2,7-9H2,1H3,(H,18,19)(H,20,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.