CAS 88144-78-9
:2-({[5-hydroxy-2-(1-hydroxyethyl)hexyl]oxy}carbonyl)benzoic acid
Description:
2-({[5-hydroxy-2-(1-hydroxyethyl)hexyl]oxy}carbonyl)benzoic acid, with the CAS number 88144-78-9, is a chemical compound that features a complex structure characterized by a benzoic acid moiety linked to a hexyl chain that includes hydroxyl and carbonyl functional groups. This compound is likely to exhibit properties typical of both carboxylic acids and alcohols, such as solubility in polar solvents and potential for hydrogen bonding. The presence of the hydroxyl groups suggests it may have increased reactivity and the ability to participate in various chemical reactions, including esterification and oxidation. Additionally, the hexyl chain may impart hydrophobic characteristics, influencing its solubility and interaction with biological membranes. This compound could be of interest in pharmaceutical applications or as an intermediate in organic synthesis due to its functional groups. Its specific applications and behavior would depend on the context of use, including concentration, pH, and the presence of other chemical species.
Formula:C16H22O6
InChI:InChI=1/C16H22O6/c1-10(17)7-8-12(11(2)18)9-22-16(21)14-6-4-3-5-13(14)15(19)20/h3-6,10-12,17-18H,7-9H2,1-2H3,(H,19,20)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-({[5-hydroxy-2-(1-hydroxyethyl)hexyl]oxy}carbonyl)benzoic acid
CAS:Formula:C16H22O6Molecular weight:310.3423
