CAS 88144-82-5

2-{[(2-acetylhexyl)oxy]carbonyl}benzoic acid

Description:

2-{[(2-acetylhexyl)oxy]carbonyl}benzoic acid, with the CAS number 88144-82-5, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an ester functional group. This compound features a carbonyl group linked to a hexyl chain that is further substituted with an acetyl group, contributing to its hydrophobic characteristics. The presence of both hydrophilic (carboxylic acid) and hydrophobic (alkyl chain) components suggests that it may exhibit amphiphilic properties, making it potentially useful in applications such as surfactants or emulsifiers. The compound's molecular structure indicates that it may participate in various chemical reactions, including esterification and hydrolysis. Its solubility profile is likely influenced by the balance between the polar carboxylic acid group and the nonpolar alkyl chain. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical or agrochemical research. Overall, its unique structural features make it a candidate for further study in various chemical and industrial applications.

Formula: C₁₆H₂₀O₅

InChI: InChI=1/C16H20O5/c1-3-4-7-12(11(2)17)10-21-16(20)14-9-6-5-8-13(14)15(18)19/h5-6,8-9,12H,3-4,7,10H2,1-2H3,(H,18,19)

SMILES: CCCCC(COC(=O)c1ccccc1C(=O)O)C(=O)C

Mono-2-(1-oxoethyl)hexyl-d4 Phthalate

Controlled Product

CAS: 88144-82-5

Formula: C₁₅D₄H₁₆O₃·CO₂

Color and Shape: Neat

Molecular weight: 296.352

Ref: TR-M524782

Mono-2-(1-oxoethyl)hexyl Phthalate

Controlled Product

CAS: 88144-82-5

Formula: C₁₅H₂₀O₃·CO₂

Color and Shape: Neat

Molecular weight: 292.327

Ref: TR-M524780