CymitQuimica logo

CAS 881441-03-8

:

4-{[(pyridin-2-ylmethyl)amino]methyl}benzoic acid

Description:
4-{[(Pyridin-2-ylmethyl)amino]methyl}benzoic acid, with the CAS number 881441-03-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a pyridine ring. This compound features an amino group that is linked to a pyridine ring through a methylene bridge, contributing to its potential as a ligand in coordination chemistry. The presence of both the carboxylic acid and the pyridine nitrogen allows for various interactions, such as hydrogen bonding and coordination with metal ions. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in materials science for creating functionalized surfaces or polymers. Its reactivity and interaction with biological systems can be further explored for therapeutic purposes or as a building block in organic synthesis.
Formula:C14H14N2O2
InChI:InChI=1/C14H14N2O2/c17-14(18)12-6-4-11(5-7-12)9-15-10-13-3-1-2-8-16-13/h1-8,15H,9-10H2,(H,17,18)
SMILES:c1ccnc(c1)CNCc1ccc(cc1)C(=O)O
Synonyms:
  • Benzoic Acid, 4-[[(2-Pyridinylmethyl)Amino]Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.