CAS 88145-89-5
:6-Bromoquinazoline-2,4-dione
Description:
6-Bromoquinazoline-2,4-dione is a heterocyclic organic compound characterized by its quinazoline core, which features a bromine substituent at the 6-position and two carbonyl groups at the 2 and 4 positions. This compound typically exhibits a solid state at room temperature and is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the bromine atom can influence its reactivity and solubility, while the dione functional groups contribute to its ability to participate in various chemical reactions, such as nucleophilic attacks or cyclization processes. Additionally, 6-Bromoquinazoline-2,4-dione may exhibit fluorescence properties, making it useful in certain analytical applications. Its synthesis often involves the bromination of quinazoline derivatives, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-4-1-2-6-5(3-4)7(12)11-8(13)10-6/h1-3H,(H2,10,11,12,13)
SMILES:c1cc2c(cc1Br)c(nc(n2)O)O
Synonyms:- 6-Bromo-1H,3H-quinazoline-2,4-dione
- 6-Bromoquinazoline-2,4(1H,3H)-dione
- 6-Bromo-2,4(1H,3H)-Quinazolinedione
- 6-Bromoquinazoline-2,4-Diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Bromoquinazoline-2,4(1H,3H)-dione, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H5BrN2O2Purity:97%Molecular weight:241.046-Bromo-2,4(1H,3H)-quinazolinedione
CAS:Formula:C8H5BrN2O2Purity:98%Color and Shape:SolidMolecular weight:241.04156-Bromoquinazoline-2,4(1H,3H)-dione
CAS:6-Bromoquinazoline-2,4(1H,3H)-dioneFormula:C8H5BrN2O2Purity:≥95%Color and Shape: off-white solidMolecular weight:241.04g/mol6-Bromo-1H-quinazoline-2,4-dione
CAS:Formula:C8H5BrN2O2Purity:95%Color and Shape:SolidMolecular weight:241.044



