CAS 88148-66-7

3-Pyridinecarbonitrile, 4-(2-chlorophenyl)-1,2-dihydro-2-oxo-

Description:

3-Pyridinecarbonitrile, 4-(2-chlorophenyl)-1,2-dihydro-2-oxo- is a chemical compound characterized by its pyridine and carbonitrile functional groups, along with a dihydro-2-oxo structure. This compound typically exhibits a molecular structure that includes a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the 2-chlorophenyl group suggests that it may have specific interactions due to the electronegative chlorine atom, which can influence its reactivity and solubility. The dihydro-2-oxo moiety indicates that the compound may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. In terms of physical properties, compounds of this nature often display moderate to high polarity, affecting their solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Overall, 3-Pyridinecarbonitrile, 4-(2-chlorophenyl)-1,2-dihydro-2-oxo- is a versatile compound with potential applications in medicinal chemistry and organic synthesis.

Formula: C₁₂H₇ClN₂O

InChI: InChI=1S/C12H7ClN2O/c13-11-4-2-1-3-9(11)8-5-6-15-12(16)10(8)7-14/h1-6H,(H,15,16)

InChI key: JSYONPYPENKRRM-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)C2=C(C(=O)NC=C2)C#N)Cl