CAS 88148-67-8

3-Pyridinecarboxamide, 4-(2-bromophenyl)-1,2-dihydro-2-oxo-

Description:

3-Pyridinecarboxamide, 4-(2-bromophenyl)-1,2-dihydro-2-oxo- is a chemical compound characterized by its pyridine and amide functional groups, which contribute to its potential biological activity. The presence of a bromophenyl group suggests that it may exhibit unique electronic properties and reactivity due to the bromine substituent. This compound is likely to be a solid at room temperature, with moderate solubility in polar solvents, typical of many amides. Its structure indicates potential for hydrogen bonding, which can influence its melting point and solubility. The dihydro-2-oxo moiety suggests that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. Additionally, compounds with similar structures have been studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. As with any chemical substance, safety data and handling precautions should be consulted, particularly due to the presence of the bromine atom, which can pose environmental and health risks.

Formula: C₁₂H₉BrN₂O₂

InChI: InChI=1S/C12H9BrN2O2/c13-9-4-2-1-3-7(9)8-5-6-15-12(17)10(8)11(14)16/h1-6H,(H2,14,16)(H,15,17)

InChI key: STWGGLPBGZJEEP-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)C2=C(C(=O)NC=C2)C(=O)N)Br