CAS 88149-48-8
:2,4-Dibromo-6-(methylthio)benzenamine
Description:
2,4-Dibromo-6-(methylthio)benzenamine, with the CAS number 88149-48-8, is an organic compound characterized by the presence of two bromine atoms and a methylthio group attached to a benzene ring that also contains an amine functional group. This compound typically exhibits a solid state at room temperature and is likely to be insoluble or only slightly soluble in water, while being more soluble in organic solvents due to its hydrophobic characteristics. The presence of bromine atoms contributes to its potential reactivity and may influence its electronic properties, making it useful in various chemical syntheses or as an intermediate in the production of other compounds. The methylthio group can enhance the compound's nucleophilicity and may also affect its biological activity. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Overall, 2,4-Dibromo-6-(methylthio)benzenamine is of interest in fields such as organic synthesis, materials science, and potentially in pharmaceuticals, depending on its specific applications.
Formula:C7H7Br2NS
InChI:InChI=1S/C7H7Br2NS/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,10H2,1H3
InChI key:InChIKey=KRXHPDQZNARDMQ-UHFFFAOYSA-N
SMILES:S(C)C1=C(N)C(Br)=CC(Br)=C1
Synonyms:- Benzenamine, 2,4-dibromo-6-(methylthio)-
- 2,4-Dibromo-6-(methylthio)aniline
- 2,4-Dibromo-6-(methylthio)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
