CAS 88150-75-8
:Ethyl 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-3-oxobutanoate
Description:
Ethyl 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-3-oxobutanoate, with the CAS number 88150-75-8, is a chemical compound that belongs to the class of esters. It features a complex structure characterized by the presence of an ethyl ester group, a butanoate moiety, and a substituted isoindole derivative. This compound is typically recognized for its potential applications in organic synthesis and medicinal chemistry, particularly due to the isoindole framework, which is often associated with biological activity. The presence of the dioxo group suggests potential reactivity, making it a candidate for further chemical transformations. Its solubility and stability can vary based on the solvent and conditions used, which is crucial for its application in laboratory settings. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the intricate nature of organic molecules and their diverse functionalities in chemical research.
Formula:C16H17NO6
InChI:InChI=1S/C16H17NO6/c1-2-23-14(19)9-11(18)10-22-8-7-17-15(20)12-5-3-4-6-13(12)16(17)21/h3-6H,2,7-10H2,1H3
InChI key:InChIKey=RIGKLAOKQFKWNN-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCOCC(CC(OCC)=O)=O)=CC=CC2
Synonyms:- 4-(2-Phthalimidoethoxy)acetoacetic acid ethyl ester
- 4-[2-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)ethoxy]-3-oxobutanoic acid ethyl ester
- Butanoic acid, 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-3-oxo-, ethyl ester
- Ethyl 4-(2-phthalimidoethoxy)acetoacetate
- Ethyl 4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-3-oxobutanoate
- Ethyl-4(2-phthalimido ethoxy)acetoacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate
CAS:Formula:C16H17NO6Purity:97%Color and Shape:LiquidMolecular weight:319.3093Ethyl 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoate
CAS:Ethyl 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoatePurity:95%Molecular weight:319.31g/molEthyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate
CAS:Formula:C16H17NO6Purity:97%Color and Shape:SolidMolecular weight:319.3134-(2-Phthalimidoethoxy)acetoacetic Acid Ethyl Ester
CAS:Controlled ProductApplications 4-(2-Phthalimidoethoxy)acetoacetic Acid Ethyl Ester is an intermediate in the synthesis of Amlodipine Besilate (A633500) related compounds.
References Litvic, M., et al.: Green. Chem., 7, 771 (2005);Formula:C16H17NO6Color and Shape:NeatMolecular weight:319.31Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate
CAS:Please enquire for more information about Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C16H17NO6Purity:Min. 95%Molecular weight:319.31 g/mol






