CAS 88150-90-7

Hydrazinesulfonic acid, 2-(2,3-dihydro-2,2-dimethyl-7-benzofuranyl)-

Description:

Hydrazinesulfonic acid, 2-(2,3-dihydro-2,2-dimethyl-7-benzofuranyl)-, identified by CAS number 88150-90-7, is a chemical compound that features a hydrazine functional group attached to a sulfonic acid moiety, along with a substituted benzofuran structure. This compound is characterized by its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its unique structural properties. The presence of the benzofuran ring contributes to its aromatic characteristics, while the hydrazine and sulfonic acid groups impart reactivity and solubility in polar solvents. Hydrazinesulfonic acid derivatives are often studied for their biological activity, including potential antioxidant and anti-inflammatory properties. Additionally, the compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Safety considerations are essential when handling this substance, as hydrazine derivatives can be toxic and potentially hazardous. Overall, this compound represents a fascinating area of study within organic chemistry and materials science.

Formula: C₁₀H₁₄N₂O₄S

InChI: InChI=1S/C10H14N2O4S/c1-10(2)6-7-4-3-5-8(9(7)16-10)11-12-17(13,14)15/h3-5,11-12H,6H2,1-2H3,(H,13,14,15)

InChI key: CYIAIYDIGWTAIV-UHFFFAOYSA-N

SMILES: CC1(CC2=C(O1)C(=CC=C2)NNS(=O)(=O)O)C