CAS 88152-00-5

4-[2-(2-phenyl-1H-indol-3-yl)hydrazino]-N-pyrimidin-2-ylbenzenesulfonamide

Description:

4-[2-(2-phenyl-1H-indol-3-yl)hydrazino]-N-pyrimidin-2-ylbenzenesulfonamide, with the CAS number 88152-00-5, is a chemical compound that belongs to the class of sulfonamides. This compound features a complex structure characterized by the presence of a pyrimidine ring, an indole moiety, and a sulfonamide functional group. It exhibits potential biological activity, which may include antimicrobial or anticancer properties, making it of interest in pharmaceutical research. The presence of the hydrazino group suggests potential reactivity, possibly allowing for further derivatization or interaction with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in biological systems. Additionally, the compound's molecular interactions, such as hydrogen bonding and π-π stacking due to the aromatic rings, may influence its pharmacokinetic and pharmacodynamic profiles. Overall, this compound represents a unique scaffold for drug development, particularly in the context of targeting specific biological pathways.

Formula: C₂₄H₂₀N₆O₂S

InChI: InChI=1/C24H20N6O2S/c31-33(32,30-24-25-15-6-16-26-24)19-13-11-18(12-14-19)28-29-23-20-9-4-5-10-21(20)27-22(23)17-7-2-1-3-8-17/h1-16,27-29H,(H,25,26,30)

InChI key: GEYRMRADYOHWLO-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)NNC4=CC=C(C=C4)S(=O)(=O)NC5=NC=CC=N5