CAS 88152-01-6

N-(4,6-dimethylpyrimidin-2-yl)-4-[2-(2-phenyl-1H-indol-3-yl)hydrazino]benzenesulfonamide

Description:

N-(4,6-dimethylpyrimidin-2-yl)-4-[2-(2-phenyl-1H-indol-3-yl)hydrazino]benzenesulfonamide is a complex organic compound characterized by its unique structural features, which include a pyrimidine ring, a sulfonamide group, and an indole moiety. This compound is typically classified as a sulfonamide derivative, which often exhibits biological activity, particularly in medicinal chemistry. The presence of the pyrimidine and indole rings suggests potential interactions with biological targets, making it a candidate for pharmaceutical applications. The compound's hydrazino group may also contribute to its reactivity and ability to form various derivatives. In terms of solubility, compounds of this nature can vary widely, often depending on the substituents and their electronic properties. Additionally, the molecular weight and specific functional groups influence its stability and reactivity. Overall, this compound's intricate structure and functional groups suggest potential utility in drug development, particularly in targeting specific biological pathways or diseases.

Formula: C₂₆H₂₄N₆O₂S

InChI: InChI=1/C26H24N6O2S/c1-17-16-18(2)28-26(27-17)32-35(33,34)21-14-12-20(13-15-21)30-31-25-22-10-6-7-11-23(22)29-24(25)19-8-4-3-5-9-19/h3-16,29-31H,1-2H3,(H,27,28,32)

InChI key: FUFXWAPSSFOQKA-UHFFFAOYSA-N

SMILES: CC1=CC(=NC(=N1)NS(=O)(=O)C2=CC=C(C=C2)NNC3=C(NC4=CC=CC=C43)C5=CC=CC=C5)C