CAS 88152-48-1

Benzeneacetamide, N-(3-mercapto-1-oxo-2-butenyl)-

Description:

Benzeneacetamide, N-(3-mercapto-1-oxo-2-butenyl)-, identified by CAS number 88152-48-1, is an organic compound characterized by its amide functional group linked to a benzene ring and a side chain containing a mercapto group. This compound features a unique structure that includes a butenyl moiety with a carbonyl and thiol functional group, which can impart specific reactivity and biological activity. The presence of the mercapto group suggests potential for thiol-related chemistry, including redox reactions and interactions with metal ions. Benzeneacetamide derivatives are often studied for their pharmacological properties, including potential anti-inflammatory and antimicrobial activities. The compound's solubility, stability, and reactivity can be influenced by the substituents on the benzene ring and the butenyl chain. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of the thiol group, which can be reactive and may have implications for toxicity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₂H₁₃NO₂S

InChI: InChI=1S/C12H13NO2S/c1-9(16)7-11(14)13-12(15)8-10-5-3-2-4-6-10/h2-7,16H,8H2,1H3,(H,13,14,15)

InChI key: CWIHOUJIYDTTGT-UHFFFAOYSA-N

SMILES: CC(=CC(=O)NC(=O)CC1=CC=CC=C1)S