CAS 88152-61-8

4,8-Methanothiazolo[4,5-c]azocine, 5-benzoyl-4,5,6,7,8,9-hexahydro-

Description:

4,8-Methanothiazolo[4,5-c]azocine, 5-benzoyl-4,5,6,7,8,9-hexahydro- is a complex organic compound characterized by its unique bicyclic structure, which incorporates both thiazole and azocine moieties. This compound features a benzoyl group, contributing to its potential as a pharmacophore in medicinal chemistry. The presence of multiple rings and functional groups suggests that it may exhibit interesting chemical reactivity and biological activity. Typically, such compounds can be evaluated for their potential applications in drug development, particularly in areas like cancer therapy or antimicrobial activity, due to their structural diversity. The hexahydro component indicates that the compound is saturated, which may influence its stability and solubility properties. Additionally, the specific arrangement of atoms and functional groups can lead to unique interactions with biological targets, making it a subject of interest in research. As with many organic compounds, its properties, including melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.

Formula: C₁₆H₁₆N₂OS

InChI: InChI=1S/C16H16N2OS/c19-16(12-4-2-1-3-5-12)18-7-6-11-8-13(18)15-14(9-11)20-10-17-15/h1-5,10-11,13H,6-9H2

InChI key: UDACYPLYYBAQKO-UHFFFAOYSA-N

SMILES: C1CN(C2CC1CC3=C2N=CS3)C(=O)C4=CC=CC=C4