CAS 88152-80-1

4,8-Methanothiazolo[5,4-c]azocine, 4,5,6,7,8,9-hexahydro-5-methyl-

Description:

4,8-Methanothiazolo[5,4-c]azocine, 4,5,6,7,8,9-hexahydro-5-methyl- (CAS 88152-80-1) is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thiazole and azocine moieties. This compound features a saturated ring system, which contributes to its stability and potential biological activity. The presence of the thiazole ring introduces sulfur and nitrogen atoms into the structure, enhancing its reactivity and potential for forming various derivatives. The hexahydro configuration indicates that the compound is fully saturated, which may influence its solubility and interaction with biological systems. Additionally, the methyl group at the 5-position can affect the compound's lipophilicity and overall pharmacological properties. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, including antimicrobial and anticancer activities. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₀H₁₄N₂S

InChI: InChI=1S/C10H14N2S/c1-12-3-2-7-4-8-10(9(12)5-7)13-6-11-8/h6-7,9H,2-5H2,1H3

InChI key: FPGSROKELZSZEC-UHFFFAOYSA-N

SMILES: CN1CCC2CC1C3=C(C2)N=CS3