CAS 88153-34-8

Benzaldehyde, 2,6-dimethoxy-4-(1-methylethyl)-

Description:

Benzaldehyde, 2,6-dimethoxy-4-(1-methylethyl)-, also known by its CAS number 88153-34-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple functional groups. This compound features two methoxy (-OCH3) groups at the 2 and 6 positions and an isopropyl group (-C(CH3)2) at the 4 position of the benzene ring. It is typically a colorless to pale yellow liquid with a pleasant, almond-like odor, characteristic of benzaldehyde derivatives. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and stability. This compound is often used in the synthesis of various organic compounds and may have applications in the fragrance and flavor industries due to its aromatic properties. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₂H₁₆O₃

InChI: InChI=1S/C12H16O3/c1-8(2)9-5-11(14-3)10(7-13)12(6-9)15-4/h5-8H,1-4H3

InChI key: JPAGXQONFKYUJT-UHFFFAOYSA-N

SMILES: CC(C)C1=CC(=C(C(=C1)OC)C=O)OC