CymitQuimica logo

CAS 88154-25-0

:

3,8-Diimino-5-methyl-2,4,7,9-tetraazadecanediimidamide

Description:
3,8-Diimino-5-methyl-2,4,7,9-tetraazadecanediimidamide, with the CAS number 88154-25-0, is a synthetic organic compound characterized by its complex structure featuring multiple amino groups and a tetraazadecane backbone. This compound is notable for its potential applications in various fields, including medicinal chemistry and materials science, due to its ability to form coordination complexes with metal ions. The presence of multiple imino and amino functional groups contributes to its high reactivity and solubility in polar solvents. Additionally, the methyl group at the 5-position enhances its steric properties, which can influence its interaction with biological targets or other chemical species. The compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 3,8-Diimino-5-methyl-2,4,7,9-tetraazadecanediimidamide represents a class of polyfunctional compounds that can be explored for diverse applications in research and industry.
Formula:C7H18N10
InChI:InChI=1S/C7H18N10/c1-3(15-7(13)17-5(10)11)2-14-6(12)16-4(8)9/h3H,2H2,1H3,(H6,8,9,12,14,16)(H6,10,11,13,15,17)
InChI key:InChIKey=RILBKYGGCMZHAB-UHFFFAOYSA-N
SMILES:C(NC(CNC(NC(=N)N)=N)C)(NC(=N)N)=N
Synonyms:
  • 2,4,7,9-Tetraazadecanediimidamide, 3,8-diimino-5-methyl-
  • 3,8-Diimino-5-methyl-2,4,7,9-tetraazadecanediimidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.