CAS 88159-18-6
:11-[3-(2-Penten-1-yl)-2-oxiranyl]-9-undecenoic acid
Description:
11-[3-(2-Penten-1-yl)-2-oxiranyl]-9-undecenoic acid, with the CAS number 88159-18-6, is a chemical compound characterized by its unique structure that includes both an unsaturated fatty acid and an epoxide group. This compound features a long hydrocarbon chain, which contributes to its hydrophobic properties, while the presence of the epoxide ring introduces reactivity that can be exploited in various chemical reactions. The unsaturation in the fatty acid portion allows for potential polymerization or cross-linking reactions, making it of interest in materials science and organic synthesis. Additionally, the presence of the 2-pentenyl group suggests potential applications in the synthesis of more complex organic molecules or as a building block in the development of bioactive compounds. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions influenced by its functional groups and overall structure. As with many organic compounds, safety and handling precautions should be observed due to its potential reactivity.
Formula:C18H30O3
InChI:InChI=1S/C18H30O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h3,8,10-11,16-17H,2,4-7,9,12-15H2,1H3,(H,19,20)
InChI key:InChIKey=BKKGUKSHPCTUGE-UHFFFAOYSA-N
SMILES:C(C=CCCCCCCCC(O)=O)C1C(CC=CCC)O1
Synonyms:- 11-[3-(2-Penten-1-yl)-2-oxiranyl]-9-undecenoic acid
- 9-Undecenoic acid, 11-[3-(2-penten-1-yl)-2-oxiranyl]-
- 9-Undecenoic acid, 11-[3-(2-pentenyl)oxiranyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
