CAS 88159-19-7

2,1,3-Benzoxadiazole, 4-(1-aziridinyl)-7-nitro-

Description:

2,1,3-Benzoxadiazole, 4-(1-aziridinyl)-7-nitro- is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxadiazole moiety and an aziridine group. The presence of the nitro group at the 7-position contributes to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its aziridine ring suggests potential for ring-opening reactions, making it a candidate for further chemical modifications. The nitro group can also influence the electronic properties of the molecule, potentially enhancing its biological activity. As with many nitrogen-containing heterocycles, this compound may exhibit interesting pharmacological properties, making it a subject of interest for research in drug development. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds and aziridines.

Formula: C₈H₆N₄O₃

InChI: InChI=1S/C8H6N4O3/c13-12(14)6-2-1-5(11-3-4-11)7-8(6)10-15-9-7/h1-2H,3-4H2

InChI key: GVPYYEPUPIEXON-UHFFFAOYSA-N

SMILES: C1CN1C2=CC=C(C3=NON=C23)[N+](=O)[O-]