CAS 88159-25-5
:m-Tolyltetrazolium red
Description:
m-Tolyltetrazolium red, also known by its CAS number 88159-25-5, is a chemical compound commonly used as a redox indicator in various biochemical assays. It is characterized by its tetrazolium structure, which allows it to undergo reduction in the presence of viable cells, leading to a color change that can be quantitatively measured. This property makes it particularly useful in cell viability assays, where it helps to assess metabolic activity. The compound is soluble in water and organic solvents, which enhances its versatility in laboratory applications. Additionally, m-Tolyltetrazolium red is often employed in microbiological studies to differentiate between living and dead cells, as only metabolically active cells can reduce the tetrazolium salt to its formazan form, resulting in a distinct color change. Its stability under various conditions and ease of use make it a valuable tool in both research and clinical settings. However, as with all chemical substances, proper handling and safety precautions should be observed to mitigate any potential hazards.
Formula:C20H17ClN4
InChI:InChI=1/C20H17N4.ClH/c1-16-9-8-14-19(15-16)24-22-20(17-10-4-2-5-11-17)21-23(24)18-12-6-3-7-13-18;/h2-15H,1H3;1H/q+1;/p-1
Synonyms:- 2-(3-methylphenyl)-3,5-diphenyl-2H-tetrazol-3-ium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
m-Tolyltetrazolium Red
CAS:Formula:C20H17ClN4Purity:>80.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:348.83M-Tolyltetrazolium Red
CAS:Formula:C20H17ClN4Purity:80.0%Color and Shape:SolidMolecular weight:348.8288


