CAS 88159-26-6

2H-Tetrazolium, 2,3-bis(3-ethylphenyl)-5-phenyl-, chloride (1:1)

Description:

2H-Tetrazolium, 2,3-bis(3-ethylphenyl)-5-phenyl-, chloride (1:1), with CAS number 88159-26-6, is a chemical compound that belongs to the class of tetrazolium salts. These compounds are characterized by their tetrazole ring structure, which consists of four nitrogen atoms and one carbon atom, contributing to their unique chemical properties. This specific tetrazolium salt features a complex organic structure with multiple phenyl and ethyl substituents, which can influence its solubility, stability, and reactivity. Tetrazolium salts are often used in biological assays, particularly in cell viability tests, due to their ability to be reduced by living cells to form colored formazan products. The chloride component indicates that it is a salt, which typically enhances its solubility in polar solvents. Overall, the characteristics of this compound make it valuable in various research applications, particularly in biochemistry and pharmacology, where it can serve as a redox indicator or a substrate for enzymatic reactions.

Formula: C₂₃H₂₃N₄Cl

InChI: InChI=1S/C23H23N4.ClH/c1-3-18-10-8-14-21(16-18)26-24-23(20-12-6-5-7-13-20)25-27(26)22-15-9-11-19(4-2)17-22;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1

InChI key: InChIKey=TXWUTNPZLRAZNI-UHFFFAOYSA-M

SMILES: C(C)C=1C=C(N2[N+](=NC(=N2)C3=CC=CC=C3)C4=CC(CC)=CC=C4)C=CC1.[Cl-]

Synonyms:

• 2H-Tetrazolium, 2,3-bis(3-ethylphenyl)-5-phenyl-, chloride
• 2H-Tetrazolium, 2,3-bis(3-ethylphenyl)-5-phenyl-, chloride (1:1)

2H-Tetrazolium, 2,3-bis(3-ethylphenyl)-5-phenyl-, chloride

CAS: 88159-26-6

Formula: C₂₃H₂₅ClN₄

Molecular weight: 392.9244

Ref: IN-DA004CRM